CAS 850623-72-2 is the registry number for Potassium (3,5-dinitro-2-methylphenyl)trifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Potassium trifluoro-(2-methyl-3,5-dinitrophenyl)boranuide (CAS 850623-72-2) is a chemical compound with the molecular formula C7H5BF3KN2O4 and a molecular weight of 288.03 g/mol. IUPAC name: potassium trifluoro-(2-methyl-3,5-dinitrophenyl)boranuide. InChIKey: WATHPRZGMORMCV-UHFFFAOYSA-N.
| Molecular formula | C7H5BF3KN2O4 |
|---|---|
| Molecular weight | 288.03 g/mol |
| IUPAC name | potassium trifluoro-(2-methyl-3,5-dinitrophenyl)boranuide |
| InChIKey | WATHPRZGMORMCV-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC(=C1C)[N+](=O)[O-])[N+](=O)[O-])(F)(F)F.[K+] |
Computed by PubChem (NCBI)