CAS 850650-61-2 is the registry number for 3-Phenylnaphthalen-1-yl trifluoromethanesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(3-phenylnaphthalen-1-yl) trifluoromethanesulfonate (CAS 850650-61-2) is a chemical compound with the molecular formula C17H11F3O3S and a molecular weight of 352.3 g/mol. IUPAC name: (3-phenylnaphthalen-1-yl) trifluoromethanesulfonate. InChIKey: ABDYODDUCKVJMF-UHFFFAOYSA-N.
| Molecular formula | C17H11F3O3S |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | (3-phenylnaphthalen-1-yl) trifluoromethanesulfonate |
| InChIKey | ABDYODDUCKVJMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)