CAS 850808-70-7 is the registry number for Flupentixol Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
9-prop-2-enyl-2-(trifluoromethyl)thioxanthen-9-ol (CAS 850808-70-7) is a chemical compound with the molecular formula C17H13F3OS and a molecular weight of 322.3 g/mol. IUPAC name: 9-prop-2-enyl-2-(trifluoromethyl)thioxanthen-9-ol. InChIKey: SDJYSPKYXOWJHB-UHFFFAOYSA-N.
| Molecular formula | C17H13F3OS |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 9-prop-2-enyl-2-(trifluoromethyl)thioxanthen-9-ol |
| InChIKey | SDJYSPKYXOWJHB-UHFFFAOYSA-N |
| SMILES | C=CCC1(C2=CC=CC=C2SC3=C1C=C(C=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)