Products 850836-81-6

CAS 850836-81-6 is the registry number for Beta-guanidinopropionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

3-(diaminomethylideneamino)propanoic acid;hydrochloride (CAS 850836-81-6) is a chemical compound with the molecular formula C4H10ClN3O2 and a molecular weight of 167.59 g/mol. IUPAC name: 3-(diaminomethylideneamino)propanoic acid;hydrochloride. InChIKey: WYCGPQCUZKUBFP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H10ClN3O2
Molecular weight167.59 g/mol
IUPAC name3-(diaminomethylideneamino)propanoic acid;hydrochloride
InChIKeyWYCGPQCUZKUBFP-UHFFFAOYSA-N
SMILESC(CN=C(N)N)C(=O)O.Cl

Computed by PubChem (NCBI)