Products 850859-64-2
CAS 850859-64-2 is the registry number for Fmoc-N(oNv)-Gly-OH. Offered by: Iris Biotech. Available pack sizes: 1g.
2-[(4,5-dimethoxy-2-nitrophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 850859-64-2) is a chemical compound with the molecular formula C26H24N2O8 and a molecular weight of 492.5 g/mol. IUPAC name: 2-[(4,5-dimethoxy-2-nitrophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: FAQGWVUKYHWHIB-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O8 |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | 2-[(4,5-dimethoxy-2-nitrophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | FAQGWVUKYHWHIB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CN(CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)