CAS 850883-56-6 is the registry number for ((2R,3R,4S,5S)-3-(Benzoyloxy)-4-fluoro-5-hydroxytetrahydrofuran-2-yl)methyl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-benzoyloxy-4-fluoro-5-hydroxyoxolan-2-yl)methyl benzoate (CAS 850883-56-6) is a chemical compound with the molecular formula C19H17FO6 and a molecular weight of 360.3 g/mol. IUPAC name: (3-benzoyloxy-4-fluoro-5-hydroxyoxolan-2-yl)methyl benzoate. InChIKey: OGTHJSFFOVDKCK-UHFFFAOYSA-N.
| Molecular formula | C19H17FO6 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | (3-benzoyloxy-4-fluoro-5-hydroxyoxolan-2-yl)methyl benzoate |
| InChIKey | OGTHJSFFOVDKCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)O)F)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)