CAS 1187620-57-0 is the registry number for Clofarabine Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5S)-4-benzoyloxy-5-fluoro-3-hydroxyoxolan-2-yl]methyl benzoate (CAS 1187620-57-0) is a chemical compound with the molecular formula C19H17FO6 and a molecular weight of 360.3 g/mol. IUPAC name: [(2R,3R,4R,5S)-4-benzoyloxy-5-fluoro-3-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: BEWWVVXPXXLMBB-QBPKDAKJSA-N.
| Molecular formula | C19H17FO6 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-4-benzoyloxy-5-fluoro-3-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | BEWWVVXPXXLMBB-QBPKDAKJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)F)OC(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)