CAS 850896-71-8 appears in our catalog under these names: Etoricoxib-d3, Etoricoxib-d3, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 10mg, 50mg, 2.5 mg, 25 mg.
5-chloro-2-(6-methyl-3-pyridinyl)-3-[4-(trideuteriomethylsulfonyl)phenyl]pyridine (CAS 850896-71-8) is a chemical compound with the molecular formula C18H15ClN2O2S and a molecular weight of 361.9 g/mol. IUPAC name: 5-chloro-2-(6-methyl-3-pyridinyl)-3-[4-(trideuteriomethylsulfonyl)phenyl]pyridine. InChIKey: MNJVRJDLRVPLFE-BMSJAHLVSA-N.
| Molecular formula | C18H15ClN2O2S |
|---|---|
| Molecular weight | 361.9 g/mol |
| IUPAC name | 5-chloro-2-(6-methyl-3-pyridinyl)-3-[4-(trideuteriomethylsulfonyl)phenyl]pyridine |
| InChIKey | MNJVRJDLRVPLFE-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)(=O)C1=CC=C(C=C1)C2=C(N=CC(=C2)Cl)C3=CN=C(C=C3)C |
Computed by PubChem (NCBI)