CAS 850991-33-2 appears in our catalog under these names: (5-Phenoxy-3-pyridinyl)boronic acid, 96%, (5-Phenoxypyridin-3-yl)boronic acid, 97%, (5-Phenoxypyridin-3-yl)boronic acid, 95%, 95%, (5-Phenoxypyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(5-phenoxy-3-pyridinyl)boronic acid (CAS 850991-33-2) is a chemical compound with the molecular formula C11H10BNO3 and a molecular weight of 215.01 g/mol. IUPAC name: (5-phenoxy-3-pyridinyl)boronic acid. InChIKey: BXGLMPPRPDSZPL-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO3 |
|---|---|
| Molecular weight | 215.01 g/mol |
| IUPAC name | (5-phenoxy-3-pyridinyl)boronic acid |
| InChIKey | BXGLMPPRPDSZPL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)OC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)