CAS 851067-56-6 appears in our catalog under these names: 6-Desacetyl-6-Bromo Palbociclib, >95% (HPLC), 6-Desacetyl-6-Bromo Palbociclib, 97%, 97%, Palbociclib Impurity 10, Palbociclib Impurity 25, Palbociclib Impurity F. Offered by: TRC, Chemat, Chemat Brand, Biosynth, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g, on request, 5mg, 2mg, 10mg.
6-bromo-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one (CAS 851067-56-6) is a chemical compound with the molecular formula C22H26BrN7O and a molecular weight of 484.4 g/mol. IUPAC name: 6-bromo-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one. InChIKey: DZCHDINWDGTTBZ-UHFFFAOYSA-N.
| Molecular formula | C22H26BrN7O |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | 6-bromo-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | DZCHDINWDGTTBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)Br |
Computed by PubChem (NCBI)