Products 85109-44-0

CAS 85109-44-0 is the registry number for 3-Isothiocyanatotetrahydrothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-isothiocyanatothiolane 1,1-dioxide (CAS 85109-44-0) is a chemical compound with the molecular formula C5H7NO2S2 and a molecular weight of 177.2 g/mol. IUPAC name: 3-isothiocyanatothiolane 1,1-dioxide. InChIKey: PSOFIRZPDGOPJE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7NO2S2
Molecular weight177.2 g/mol
IUPAC name3-isothiocyanatothiolane 1,1-dioxide
InChIKeyPSOFIRZPDGOPJE-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1N=C=S

Computed by PubChem (NCBI)