Products 851095-20-0
CAS 851095-20-0 is the registry number for MIF-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-2,4-dimethoxybenzamide (CAS 851095-20-0) is a chemical compound with the molecular formula C15H13N3O5 and a molecular weight of 315.28 g/mol. IUPAC name: N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-2,4-dimethoxybenzamide. InChIKey: KTWBHAGQEGGQSO-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O5 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-2,4-dimethoxybenzamide |
| InChIKey | KTWBHAGQEGGQSO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)NC2=NN=C(O2)C3=CC=CO3)OC |
Computed by PubChem (NCBI)