CAS 851116-03-5 appears in our catalog under these names: 5-(5-Methyl-2-thienyl)thieno[2,3-d]pyrimidin-4-one, 95%, 5-(5-Methyl-2-thienyl)thieno(2,3-d)pyrimidin-4-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(5-methylthiophen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 851116-03-5) is a chemical compound with the molecular formula C11H8N2OS2 and a molecular weight of 248.3 g/mol. IUPAC name: 5-(5-methylthiophen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: SYSIILLIYRVOMM-UHFFFAOYSA-N.
| Molecular formula | C11H8N2OS2 |
|---|---|
| Molecular weight | 248.3 g/mol |
| IUPAC name | 5-(5-methylthiophen-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | SYSIILLIYRVOMM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)