CAS 851169-39-6 is the registry number for 3-Amino-n,n-diethyl-4-(4-methylpiperazin-1-yl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-amino-N,N-diethyl-4-(4-methylpiperazin-1-yl)benzenesulfonamide (CAS 851169-39-6) is a chemical compound with the molecular formula C15H26N4O2S and a molecular weight of 326.5 g/mol. IUPAC name: 3-amino-N,N-diethyl-4-(4-methylpiperazin-1-yl)benzenesulfonamide. InChIKey: FRIAPOXGQKDNEU-UHFFFAOYSA-N.
| Molecular formula | C15H26N4O2S |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | 3-amino-N,N-diethyl-4-(4-methylpiperazin-1-yl)benzenesulfonamide |
| InChIKey | FRIAPOXGQKDNEU-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)N2CCN(CC2)C)N |
Computed by PubChem (NCBI)