CAS 851175-87-6 is the registry number for 7-Chloro-3-(2-methoxyphenyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
7-chloro-3-(2-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 851175-87-6) is a chemical compound with the molecular formula C15H11ClN2O2S and a molecular weight of 318.8 g/mol. IUPAC name: 7-chloro-3-(2-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: JSZVMGGWBNBGNR-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O2S |
|---|---|
| Molecular weight | 318.8 g/mol |
| IUPAC name | 7-chloro-3-(2-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | JSZVMGGWBNBGNR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C(=O)C3=C(C=C(C=C3)Cl)NC2=S |
Computed by PubChem (NCBI)