CAS 85118-27-0 appears in our catalog under these names: Citalopram Hydrochloride, >95% (HPLC), Citalopram Hydrochloride, Citalopram (hydrochloride). Offered by: TRC, Mikromol, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 250mg, Get quote.
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride (CAS 85118-27-0) is a chemical compound with the molecular formula C20H22ClFN2O and a molecular weight of 360.9 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride. InChIKey: FXSXPIKCGLXHAW-UHFFFAOYSA-N.
| Molecular formula | C20H22ClFN2O |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride |
| InChIKey | FXSXPIKCGLXHAW-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)