CAS 851207-45-9 is the registry number for (2E)-3-(4-({4-((Carboxymethyl)carbamoyl)phenyl}sulfamoyl)phenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-3-[4-[[4-(carboxymethylcarbamoyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid (CAS 851207-45-9) is a chemical compound with the molecular formula C18H16N2O7S and a molecular weight of 404.4 g/mol. IUPAC name: (E)-3-[4-[[4-(carboxymethylcarbamoyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid. InChIKey: FCGICWBCSQZERW-XCVCLJGOSA-N.
| Molecular formula | C18H16N2O7S |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (E)-3-[4-[[4-(carboxymethylcarbamoyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
| InChIKey | FCGICWBCSQZERW-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)S(=O)(=O)NC2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)