CAS 851212-80-1 appears in our catalog under these names: CB1 agonist 1, CB1 agonist 1, 99.84%, CB1 agonist 1/ 98.56% (existing batch purity), N-(4-Methyl-3-(morpholinosulfonyl)phenyl)-2-phenoxybenzamide, 98%, 98%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 10mM/1mL, 100 mg, 10 mg, 5 mg.
N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-phenoxybenzamide (CAS 851212-80-1) is a chemical compound with the molecular formula C24H24N2O5S and a molecular weight of 452.5 g/mol. IUPAC name: N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-phenoxybenzamide. InChIKey: HASYDUIFQCRDMA-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O5S |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)-2-phenoxybenzamide |
| InChIKey | HASYDUIFQCRDMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2OC3=CC=CC=C3)S(=O)(=O)N4CCOCC4 |
Computed by PubChem (NCBI)