CAS 851233-23-3 appears in our catalog under these names: 4–bromo–N,N–bis(4–(tert–butyl)phenyl)aniline, N-(4-Bromophenyl)-4-(1,1-dimethylethyl)-N-[4-(1,1-dimethylethyl)phenyl]benzenamine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
N-(4-bromophenyl)-4-tert-butyl-N-(4-tert-butylphenyl)aniline (CAS 851233-23-3) is a chemical compound with the molecular formula C26H30BrN and a molecular weight of 436.4 g/mol. IUPAC name: N-(4-bromophenyl)-4-tert-butyl-N-(4-tert-butylphenyl)aniline. InChIKey: NPGGLZWVRNBLFX-UHFFFAOYSA-N.
| Molecular formula | C26H30BrN |
|---|---|
| Molecular weight | 436.4 g/mol |
| IUPAC name | N-(4-bromophenyl)-4-tert-butyl-N-(4-tert-butylphenyl)aniline |
| InChIKey | NPGGLZWVRNBLFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N(C2=CC=C(C=C2)C(C)(C)C)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)