CAS 85136-12-5 is the registry number for (S)-2-Pyrrolidone-5-carboxylicacidtert-butylester, 97%. Offered by: AmBeed. Available pack sizes: 10g.
Tert-butyl 5-oxopyrrolidine-2-carboxylate (CAS 85136-12-5) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: tert-butyl 5-oxopyrrolidine-2-carboxylate. InChIKey: QXGSPAGZWRTTOT-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | tert-butyl 5-oxopyrrolidine-2-carboxylate |
| InChIKey | QXGSPAGZWRTTOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(=O)N1 |
Computed by PubChem (NCBI)