CAS 85136-58-9 appears in our catalog under these names: 2-Propenoic acid,1,1'-(3,6,9,12,15-pentaoxaheptadecane-1,17-diyl) ester, 95%, Bis–acrylate–PEG6, 2-Propenoic acid, 3,6,9,12,15-pentaoxaheptadecane-1,17-diyl ester, Bis-acrylate-PEG6 98%, 2-Propenoic acid, 1,1'-(3,6,9,12,15-pentaoxaheptadecane-1,17-diyl) ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 250 mg, 1 g, 5 g, 100 mg.
2-[2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (CAS 85136-58-9) is a chemical compound with the molecular formula C18H30O9 and a molecular weight of 390.4 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate. InChIKey: DMMSYVRRDYJQSI-UHFFFAOYSA-N.
| Molecular formula | C18H30O9 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| InChIKey | DMMSYVRRDYJQSI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOCCOC(=O)C=C |
Computed by PubChem (NCBI)