Products 851525-10-5
CAS 851525-10-5 appears in our catalog under these names: (1-Benzofuran-6-yl)boronic acid, (1-Benzofuran-6-yl)boronic acid, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
1-benzofuran-6-ylboronic acid (CAS 851525-10-5) is a chemical compound with the molecular formula C8H7BO3 and a molecular weight of 161.95 g/mol. IUPAC name: 1-benzofuran-6-ylboronic acid. InChIKey: IBCSNLAKMCMGCZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BO3 |
|---|---|
| Molecular weight | 161.95 g/mol |
| IUPAC name | 1-benzofuran-6-ylboronic acid |
| InChIKey | IBCSNLAKMCMGCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CO2)(O)O |
Computed by PubChem (NCBI)