CAS 851528-09-1 appears in our catalog under these names: Lidocaine–d10, Lidocaine-d10 (N,N-diethyl-d10), >95% (HPLC), Lidocaine-d10 (N,N-diethyl-d10), 99 atom % D, min 98% Chemical Purity, Lidocaine-d10, 99.58%, D10-Lidocaine. Offered by: GLPBio, TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 1mg, 0,5mg, 5mg, 0,05g, 0,01g, 10mg, 1 mg, 10 mg.
N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide (CAS 851528-09-1) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 242.39 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide. InChIKey: NNJVILVZKWQKPM-IXKWUQSXSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 242.39 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide |
| InChIKey | NNJVILVZKWQKPM-IXKWUQSXSA-N |
| SMILES | [2H]C([2H])([2H])CN(CC(=O)NC1=C(C=CC=C1C)C)C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)