CAS 851528-79-5 appears in our catalog under these names: Seladelpar, Seladelpar, 95%, Seladelpar/ 98.39% (existing batch purity), Seladelpar 98%, 2-[4-[[(2R)-2-Ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]thio]-2-methylphenoxy]acetic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 1g, 100mg, 250mg, 10mg, 25mg, 50mg, 200mg.
2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetic acid (CAS 851528-79-5) is a chemical compound with the molecular formula C21H23F3O5S and a molecular weight of 444.5 g/mol. IUPAC name: 2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetic acid. InChIKey: JWHYSEDOYMYMNM-QGZVFWFLSA-N.
| Molecular formula | C21H23F3O5S |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 2-[4-[(2R)-2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenoxy]acetic acid |
| InChIKey | JWHYSEDOYMYMNM-QGZVFWFLSA-N |
| SMILES | CCO[C@H](COC1=CC=C(C=C1)C(F)(F)F)CSC2=CC(=C(C=C2)OCC(=O)O)C |
Computed by PubChem (NCBI)