Products 85153-63-5

CAS 85153-63-5 is the registry number for methyl 2,2-diethyl-3-oxobutanoate. Offered by: TRC, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2,2-diethyl-3-oxobutanoate (CAS 85153-63-5) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: methyl 2,2-diethyl-3-oxobutanoate. InChIKey: VNGQLWJNJCZRQU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC namemethyl 2,2-diethyl-3-oxobutanoate
InChIKeyVNGQLWJNJCZRQU-UHFFFAOYSA-N
SMILESCCC(CC)(C(=O)C)C(=O)OC

Computed by PubChem (NCBI)