CAS 851600-86-7 appears in our catalog under these names: ELN318463, 98%, ELN 318463, ELN318463, ELN318463, 99.45%, 99.45%, ELN318463, 99.45%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 25mg, 1mg, 5 mg, 50 mg.
N-[(4-bromophenyl)methyl]-4-chloro-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide (CAS 851600-86-7) is a chemical compound with the molecular formula C19H20BrClN2O3S and a molecular weight of 471.8 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-4-chloro-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide. InChIKey: KTCJYACFOQWRDO-GOSISDBHSA-N.
| Molecular formula | C19H20BrClN2O3S |
|---|---|
| Molecular weight | 471.8 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-4-chloro-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
| InChIKey | KTCJYACFOQWRDO-GOSISDBHSA-N |
| SMILES | C1CCNC(=O)[C@@H](C1)N(CC2=CC=C(C=C2)Br)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)