Products 851667-21-5

CAS 851667-21-5 is the registry number for 3-Borono-5-hydroxybenzoic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-borono-5-hydroxybenzoic acid (CAS 851667-21-5) is a chemical compound with the molecular formula C7H7BO5 and a molecular weight of 181.94 g/mol. IUPAC name: 3-borono-5-hydroxybenzoic acid. InChIKey: AWFQWXHHINIGNT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BO5
Molecular weight181.94 g/mol
IUPAC name3-borono-5-hydroxybenzoic acid
InChIKeyAWFQWXHHINIGNT-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)O)C(=O)O)(O)O

Computed by PubChem (NCBI)