Products 85168-75-8

CAS 85168-75-8 is the registry number for 1,2-Benzenedicarboxylic Acid Isodecyl Isononyl Ester. Offered by: TRC. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

1-O-(8-methylnonyl) 2-O-(7-methyloctyl) benzene-1,2-dicarboxylate (CAS 85168-75-8) is a chemical compound with the molecular formula C27H44O4 and a molecular weight of 432.6 g/mol. IUPAC name: 1-O-(8-methylnonyl) 2-O-(7-methyloctyl) benzene-1,2-dicarboxylate. InChIKey: KCQILOGVXGLBNG-UHFFFAOYSA-N.

Identity
Molecular formulaC27H44O4
Molecular weight432.6 g/mol
IUPAC name1-O-(8-methylnonyl) 2-O-(7-methyloctyl) benzene-1,2-dicarboxylate
InChIKeyKCQILOGVXGLBNG-UHFFFAOYSA-N
SMILESCC(C)CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C

Computed by PubChem (NCBI)