CAS 85169-29-5 is the registry number for Trimethylsilyl-P,P-dimethyl phosphonoacetate. Offered by: Chemat. Available pack sizes: 5g, 25g.
Trimethylsilyl 2-dimethoxyphosphorylacetate (CAS 85169-29-5) is a chemical compound with the molecular formula C7H17O5PSi and a molecular weight of 240.27 g/mol. IUPAC name: trimethylsilyl 2-dimethoxyphosphorylacetate. InChIKey: AOBJUHXMTGKIDR-UHFFFAOYSA-N.
| Molecular formula | C7H17O5PSi |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | trimethylsilyl 2-dimethoxyphosphorylacetate |
| InChIKey | AOBJUHXMTGKIDR-UHFFFAOYSA-N |
| SMILES | COP(=O)(CC(=O)O[Si](C)(C)C)OC |
Computed by PubChem (NCBI)