Products 85169-29-5

CAS 85169-29-5 is the registry number for Trimethylsilyl-P,P-dimethyl phosphonoacetate. Offered by: Chemat. Available pack sizes: 5g, 25g.

Structural formula: {0} (CAS {1})

Trimethylsilyl 2-dimethoxyphosphorylacetate (CAS 85169-29-5) is a chemical compound with the molecular formula C7H17O5PSi and a molecular weight of 240.27 g/mol. IUPAC name: trimethylsilyl 2-dimethoxyphosphorylacetate. InChIKey: AOBJUHXMTGKIDR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17O5PSi
Molecular weight240.27 g/mol
IUPAC nametrimethylsilyl 2-dimethoxyphosphorylacetate
InChIKeyAOBJUHXMTGKIDR-UHFFFAOYSA-N
SMILESCOP(=O)(CC(=O)O[Si](C)(C)C)OC

Computed by PubChem (NCBI)