CAS 851690-21-6 is the registry number for GW856464, 99.83%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 50 mg, 10 mg, 10mM/1mL, 25 mg.
6-(4-chlorophenyl)-3-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one (CAS 851690-21-6) is a chemical compound with the molecular formula C23H20ClN3O3S and a molecular weight of 453.9 g/mol. IUPAC name: 6-(4-chlorophenyl)-3-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one. InChIKey: JOAYEJZDGOLEDZ-QGZVFWFLSA-N.
| Molecular formula | C23H20ClN3O3S |
|---|---|
| Molecular weight | 453.9 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-3-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-3-methoxyphenyl]thieno[3,2-d]pyrimidin-4-one |
| InChIKey | JOAYEJZDGOLEDZ-QGZVFWFLSA-N |
| SMILES | COC1=C(C=CC(=C1)N2C=NC3=C(C2=O)SC(=C3)C4=CC=C(C=C4)Cl)N5CC[C@H](C5)O |
Computed by PubChem (NCBI)