CAS 85171-94-4 appears in our catalog under these names: 4-N,N-Bis(4-methylphenyl)-amino-benzaldehyde-N,N-diphenylhydrazone, 4-(Dibenzylamino)benzaldehyde-n,n-diphenylhydrazone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 25g, 10g, 1g.
N,N-dibenzyl-4-[(E)-(diphenylhydrazinylidene)methyl]aniline (CAS 85171-94-4) is a chemical compound with the molecular formula C33H29N3 and a molecular weight of 467.6 g/mol. IUPAC name: N,N-dibenzyl-4-[(E)-(diphenylhydrazinylidene)methyl]aniline. InChIKey: IRKBOPBCDTWDDY-YQCHCMBFSA-N.
| Molecular formula | C33H29N3 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | N,N-dibenzyl-4-[(E)-(diphenylhydrazinylidene)methyl]aniline |
| InChIKey | IRKBOPBCDTWDDY-YQCHCMBFSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C3=CC=C(C=C3)/C=N/N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)