Products 85187-95-7
CAS 85187-95-7 is the registry number for Basic red 18 (acetate). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium acetate (CAS 85187-95-7) is a chemical compound with the molecular formula C21H28ClN5O4 and a molecular weight of 449.9 g/mol. IUPAC name: 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium acetate. InChIKey: ICJCWNOPJWXPER-UHFFFAOYSA-M.
| Molecular formula | C21H28ClN5O4 |
|---|---|
| Molecular weight | 449.9 g/mol |
| IUPAC name | 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium acetate |
| InChIKey | ICJCWNOPJWXPER-UHFFFAOYSA-M |
| SMILES | CCN(CC[N+](C)(C)C)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl.CC(=O)[O-] |
Computed by PubChem (NCBI)