CAS 85196-38-9 is the registry number for Trimethylolpropane (1,1,4,4,5-D5) Phosphate. Offered by: TRC. Available pack sizes: 5mg.
3,3,5,5,8-pentadeuterio-4-ethyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide (CAS 85196-38-9) is a chemical compound with the molecular formula C6H11O4P and a molecular weight of 183.15 g/mol. IUPAC name: 3,3,5,5,8-pentadeuterio-4-ethyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide. InChIKey: BYEFHDZWRALTEN-CZMJLJOYSA-N.
| Molecular formula | C6H11O4P |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 3,3,5,5,8-pentadeuterio-4-ethyl-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane 1-oxide |
| InChIKey | BYEFHDZWRALTEN-CZMJLJOYSA-N |
| SMILES | [2H]C1C2(C(OP(=O)(O1)OC2([2H])[2H])([2H])[2H])CC |
Computed by PubChem (NCBI)