CAS 851976-50-6 appears in our catalog under these names: Rac-Monepantel, rac-Monepantel, >95% (HPLC), rac-Monepantel, 98%, 98%, rac-Monepantel, 98%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 25mg, 100mg.
N-[2-cyano-1-[5-cyano-2-(trifluoromethyl)phenoxy]propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide (CAS 851976-50-6) is a chemical compound with the molecular formula C20H13F6N3O2S and a molecular weight of 473.4 g/mol. IUPAC name: N-[2-cyano-1-[5-cyano-2-(trifluoromethyl)phenoxy]propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide. InChIKey: WTERNLDOAPYGJD-UHFFFAOYSA-N.
| Molecular formula | C20H13F6N3O2S |
|---|---|
| Molecular weight | 473.4 g/mol |
| IUPAC name | N-[2-cyano-1-[5-cyano-2-(trifluoromethyl)phenoxy]propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide |
| InChIKey | WTERNLDOAPYGJD-UHFFFAOYSA-N |
| SMILES | CC(COC1=C(C=CC(=C1)C#N)C(F)(F)F)(C#N)NC(=O)C2=CC=C(C=C2)SC(F)(F)F |
Computed by PubChem (NCBI)