CAS 85200-40-4 is the registry number for DL-Proline, 5-oxo-, iron complex, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Iron;bis(5-oxopyrrolidine-2-carboxylic acid) (CAS 85200-40-4) is a chemical compound with the molecular formula C10H14FeN2O6 and a molecular weight of 314.07 g/mol. IUPAC name: iron;bis(5-oxopyrrolidine-2-carboxylic acid). InChIKey: BDEZCLLXWQFLCA-UHFFFAOYSA-N.
| Molecular formula | C10H14FeN2O6 |
|---|---|
| Molecular weight | 314.07 g/mol |
| IUPAC name | iron;bis(5-oxopyrrolidine-2-carboxylic acid) |
| InChIKey | BDEZCLLXWQFLCA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1C(=O)O.C1CC(=O)NC1C(=O)O.[Fe] |
Computed by PubChem (NCBI)