CAS 852037-91-3 is the registry number for N-(3-Iodophenyl)-2,5-dimethylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-iodophenyl)-2,5-dimethylbenzamide (CAS 852037-91-3) is a chemical compound with the molecular formula C15H14INO and a molecular weight of 351.18 g/mol. IUPAC name: N-(3-iodophenyl)-2,5-dimethylbenzamide. InChIKey: HCRUEYROMYBPGX-UHFFFAOYSA-N.
| Molecular formula | C15H14INO |
|---|---|
| Molecular weight | 351.18 g/mol |
| IUPAC name | N-(3-iodophenyl)-2,5-dimethylbenzamide |
| InChIKey | HCRUEYROMYBPGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)NC2=CC(=CC=C2)I |
Computed by PubChem (NCBI)