CAS 852291-41-9 appears in our catalog under these names: Edoxaban Impurity 28, 5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-amine dihydrobromide 95%, 5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-amine dihydrobromide, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1g, 5g, 100mg.
5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrobromide (CAS 852291-41-9) is a chemical compound with the molecular formula C7H13Br2N3S and a molecular weight of 331.07 g/mol. IUPAC name: 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrobromide. InChIKey: ZZGWAKWQAAQNLF-UHFFFAOYSA-N.
| Molecular formula | C7H13Br2N3S |
|---|---|
| Molecular weight | 331.07 g/mol |
| IUPAC name | 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine;dihydrobromide |
| InChIKey | ZZGWAKWQAAQNLF-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)SC(=N2)N.Br.Br |
Computed by PubChem (NCBI)