CAS 852296-88-9 is the registry number for 5-Methyl-3,6-diphenyl-2-sulfanyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-methyl-3,6-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 852296-88-9) is a chemical compound with the molecular formula C19H14N2OS2 and a molecular weight of 350.5 g/mol. IUPAC name: 5-methyl-3,6-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: XBRZNWJSJLWIIY-UHFFFAOYSA-N.
| Molecular formula | C19H14N2OS2 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | 5-methyl-3,6-diphenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | XBRZNWJSJLWIIY-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=S)N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)