CAS 852362-25-5 appears in our catalog under these names: Benzopyrazine-6-boronic acid hydrochloride, 98%, Benzopyrazine-6-boronic acidHCl, Quinoxalin-6-ylboronic acid hydrochloride, 98%, 98%, Quinoxalin-6-ylboronic acid hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 2g, 500mg.
Quinoxalin-6-ylboronic acid;hydrochloride (CAS 852362-25-5) is a chemical compound with the molecular formula C8H8BClN2O2 and a molecular weight of 210.43 g/mol. IUPAC name: quinoxalin-6-ylboronic acid;hydrochloride. InChIKey: YOUKKXQGTXCLHT-UHFFFAOYSA-N.
| Molecular formula | C8H8BClN2O2 |
|---|---|
| Molecular weight | 210.43 g/mol |
| IUPAC name | quinoxalin-6-ylboronic acid;hydrochloride |
| InChIKey | YOUKKXQGTXCLHT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=NC=CN=C2C=C1)(O)O.Cl |
Computed by PubChem (NCBI)