CAS 852388-80-8 is the registry number for 5-Phenyl-2-(piperidin-1-yl)-(1,3)thiazolo(4,5-b)pyridine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylic acid (CAS 852388-80-8) is a chemical compound with the molecular formula C18H17N3O2S and a molecular weight of 339.4 g/mol. IUPAC name: 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylic acid. InChIKey: VOURJZUOTXNCLL-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O2S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 5-phenyl-2-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridine-7-carboxylic acid |
| InChIKey | VOURJZUOTXNCLL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC3=C(S2)C(=CC(=N3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)