CAS 852389-17-4 is the registry number for 2-(5-(4-Fluorophenyl)-2-oxo-2,3-dihydro-1,3,4-oxadiazol-3-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetic acid (CAS 852389-17-4) is a chemical compound with the molecular formula C10H7FN2O4 and a molecular weight of 238.17 g/mol. IUPAC name: 2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetic acid. InChIKey: MWVSPYYEJYTGJS-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O4 |
|---|---|
| Molecular weight | 238.17 g/mol |
| IUPAC name | 2-[5-(4-fluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetic acid |
| InChIKey | MWVSPYYEJYTGJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN(C(=O)O2)CC(=O)O)F |
Computed by PubChem (NCBI)