CAS 852400-11-4 is the registry number for 5-(Piperidin-1-ylsulfonyl)pyridine-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-piperidin-1-ylsulfonyl-1H-pyridine-2-thione (CAS 852400-11-4) is a chemical compound with the molecular formula C10H14N2O2S2 and a molecular weight of 258.4 g/mol. IUPAC name: 5-piperidin-1-ylsulfonyl-1H-pyridine-2-thione. InChIKey: MNXQWRWGIOERRI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S2 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | 5-piperidin-1-ylsulfonyl-1H-pyridine-2-thione |
| InChIKey | MNXQWRWGIOERRI-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CNC(=S)C=C2 |
Computed by PubChem (NCBI)