CAS 852527-97-0 is the registry number for 2-Cyanoethylalsterpaullone. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
3-(9-nitro-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)propanenitrile (CAS 852527-97-0) is a chemical compound with the molecular formula C19H14N4O3 and a molecular weight of 346.3 g/mol. IUPAC name: 3-(9-nitro-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)propanenitrile. InChIKey: UBLFSMURWWWWMH-UHFFFAOYSA-N.
| Molecular formula | C19H14N4O3 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 3-(9-nitro-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)propanenitrile |
| InChIKey | UBLFSMURWWWWMH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=C(C=CC(=C3)CCC#N)NC1=O)NC4=C2C=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)