CAS 852619-28-4 is the registry number for 1-(5-Bromothiophen-2-yl)-2,2-dihydroxyethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
1-(5-bromothiophen-2-yl)-2,2-dihydroxyethanone (CAS 852619-28-4) is a chemical compound with the molecular formula C6H5BrO3S and a molecular weight of 237.07 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)-2,2-dihydroxyethanone. InChIKey: HURJBJVXFHMXNU-UHFFFAOYSA-N.
| Molecular formula | C6H5BrO3S |
|---|---|
| Molecular weight | 237.07 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)-2,2-dihydroxyethanone |
| InChIKey | HURJBJVXFHMXNU-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C(=O)C(O)O |
Computed by PubChem (NCBI)