CAS 852626-70-1 is the registry number for Potassium (1-phenylvinyl)trifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Potassium trifluoro(1-phenylethenyl)boranuide (CAS 852626-70-1) is a chemical compound with the molecular formula C8H7BF3K and a molecular weight of 210.05 g/mol. IUPAC name: potassium trifluoro(1-phenylethenyl)boranuide. InChIKey: WOIUZJSRPCZKJJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BF3K |
|---|---|
| Molecular weight | 210.05 g/mol |
| IUPAC name | potassium trifluoro(1-phenylethenyl)boranuide |
| InChIKey | WOIUZJSRPCZKJJ-UHFFFAOYSA-N |
| SMILES | [B-](C(=C)C1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)