Products 852669-91-1

CAS 852669-91-1 is the registry number for Bupivacaine Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,1-dibutyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide iodide (CAS 852669-91-1) is a chemical compound with the molecular formula C22H37IN2O and a molecular weight of 472.4 g/mol. IUPAC name: 1,1-dibutyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide iodide. InChIKey: RWERNOJCZYOQBW-UHFFFAOYSA-N.

Identity
Molecular formulaC22H37IN2O
Molecular weight472.4 g/mol
IUPAC name1,1-dibutyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide iodide
InChIKeyRWERNOJCZYOQBW-UHFFFAOYSA-N
SMILESCCCC[N+]1(CCCCC1C(=O)NC2=C(C=CC=C2C)C)CCCC.[I-]

Computed by PubChem (NCBI)