Products 852690-88-1
CAS 852690-88-1 is the registry number for (+)-Xylariamide A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-(3-chloro-4-hydroxyphenyl)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid (CAS 852690-88-1) is a chemical compound with the molecular formula C14H14ClNO6 and a molecular weight of 327.71 g/mol. IUPAC name: (2S)-3-(3-chloro-4-hydroxyphenyl)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid. InChIKey: KCOKHEIACSQLBQ-YEZKRMTDSA-N.
| Molecular formula | C14H14ClNO6 |
|---|---|
| Molecular weight | 327.71 g/mol |
| IUPAC name | (2S)-3-(3-chloro-4-hydroxyphenyl)-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
| InChIKey | KCOKHEIACSQLBQ-YEZKRMTDSA-N |
| SMILES | COC(=O)/C=C/C(=O)N[C@@H](CC1=CC(=C(C=C1)O)Cl)C(=O)O |
Computed by PubChem (NCBI)