CAS 852706-24-2 is the registry number for 2-{(1-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)ethenyl)sulfanyl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(E)-1-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)ethenyl]sulfanylacetic acid (CAS 852706-24-2) is a chemical compound with the molecular formula C15H11NO3S2 and a molecular weight of 317.4 g/mol. IUPAC name: 2-[(E)-1-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)ethenyl]sulfanylacetic acid. InChIKey: CCDXXSIRYJZFTM-MDWZMJQESA-N.
| Molecular formula | C15H11NO3S2 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 2-[(E)-1-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)ethenyl]sulfanylacetic acid |
| InChIKey | CCDXXSIRYJZFTM-MDWZMJQESA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)/C(=C\C3=CC=CO3)/SCC(=O)O |
Computed by PubChem (NCBI)