CAS 852821-03-5 is the registry number for L–Pyrrolysine lithium. Offered by: GLPBio. Available pack sizes: 1mg.
Lithium (2S)-2-amino-6-[[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]hexanoate (CAS 852821-03-5) is a chemical compound with the molecular formula C12H20LiN3O3 and a molecular weight of 261.3 g/mol. IUPAC name: lithium (2S)-2-amino-6-[[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]hexanoate. InChIKey: HBIJBNVTTMNPPD-YMQJAAJZSA-M.
| Molecular formula | C12H20LiN3O3 |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | lithium (2S)-2-amino-6-[[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]hexanoate |
| InChIKey | HBIJBNVTTMNPPD-YMQJAAJZSA-M |
| SMILES | [Li+].C[C@@H]1CC=N[C@H]1C(=O)NCCCC[C@@H](C(=O)[O-])N |
Computed by PubChem (NCBI)