CAS 852840-37-0 is the registry number for 3-(1,3-Benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanenitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanenitrile (CAS 852840-37-0) is a chemical compound with the molecular formula C11H7F3N2OS and a molecular weight of 272.25 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanenitrile. InChIKey: ZCTBKENXWAJCIN-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2OS |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanenitrile |
| InChIKey | ZCTBKENXWAJCIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(CC#N)(C(F)(F)F)O |
Computed by PubChem (NCBI)